C23H29N5O3 — CID 91633074
cyclopropyl-[4-[6-methyl-5-[(4-nitrophenyl)methyl]-2-propan-2-ylpyrimidin-4-yl]piperazin-1-yl]methanone (PubChem CID 91633074) has the molecular formula C23H29N5O3 and a molecular weight of 423.52 g/mol. Its IUPAC name is cyclopropyl-[4-[6-methyl-5-[(4-nitrophenyl)methyl]-2-propan-2-ylpyrimidin-4-yl]piperazin-1-yl]methanone.
| Compound Name | cyclopropyl-[4-[6-methyl-5-[(4-nitrophenyl)methyl]-2-propan-2-ylpyrimidin-4-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 91633074 |
| Molecular Formula | C23H29N5O3 |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.23 |
| IUPAC Name | cyclopropyl-[4-[6-methyl-5-[(4-nitrophenyl)methyl]-2-propan-2-ylpyrimidin-4-yl]piperazin-1-yl]methanone |
| SMILES | Cc1nc(C(C)C)nc(N2CCN(C(=O)C3CC3)CC2)c1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C23H29N5O3/c1-15(2)21-24-16(3)20(14-17-4-8-19(9-5-17)28(30)31)22(25-21)26-10-12-27(13-11-26)23(29)18-6-7-18/h4-5,8-9,15,18H,6-7,10-14H2,1-3H3 |
| InChIKey | BKJZVVCHEJNGPQ-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|