C31H39N5O3 — CID 93122049
(3S)-3,5,5-trimethyl-1-[4-[6-methyl-5-[(4-nitrophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazin-1-yl]hexan-1-one (PubChem CID 93122049) has the molecular formula C31H39N5O3 and a molecular weight of 529.69 g/mol. Its IUPAC name is (3S)-3,5,5-trimethyl-1-[4-[6-methyl-5-[(4-nitrophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazin-1-yl]hexan-1-one.
| Compound Name | (3S)-3,5,5-trimethyl-1-[4-[6-methyl-5-[(4-nitrophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazin-1-yl]hexan-1-one |
|---|---|
| PubChem CID | 93122049 |
| Molecular Formula | C31H39N5O3 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | (3S)-3,5,5-trimethyl-1-[4-[6-methyl-5-[(4-nitrophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazin-1-yl]hexan-1-one |
| SMILES | Cc1nc(-c2ccccc2)nc(N2CCN(C(=O)C[C@@H](C)CC(C)(C)C)CC2)c1Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C31H39N5O3/c1-22(21-31(3,4)5)19-28(37)34-15-17-35(18-16-34)30-27(20-24-11-13-26(14-12-24)36(38)39)23(2)32-29(33-30)25-9-7-6-8-10-25/h6-14,22H,15-21H2,1-5H3/t22-/m1/s1 |
| InChIKey | AFCSRJABOQAZTO-JOCHJYFZSA-N |
| XLogP | 6.06 |
| TPSA | 92.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|