C27H32N6O3 — CID 83286415
N-tert-butyl-4-[6-methyl-5-[(2-nitrophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazine-1-carboxamide (PubChem CID 83286415) has the molecular formula C27H32N6O3 and a molecular weight of 488.59 g/mol. Its IUPAC name is N-tert-butyl-4-[6-methyl-5-[(2-nitrophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazine-1-carboxamide.
| Compound Name | N-tert-butyl-4-[6-methyl-5-[(2-nitrophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 83286415 |
| Molecular Formula | C27H32N6O3 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | N-tert-butyl-4-[6-methyl-5-[(2-nitrophenyl)methyl]-2-phenylpyrimidin-4-yl]piperazine-1-carboxamide |
| SMILES | Cc1nc(-c2ccccc2)nc(N2CCN(C(=O)NC(C)(C)C)CC2)c1Cc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C27H32N6O3/c1-19-22(18-21-12-8-9-13-23(21)33(35)36)25(29-24(28-19)20-10-6-5-7-11-20)31-14-16-32(17-15-31)26(34)30-27(2,3)4/h5-13H,14-18H2,1-4H3,(H,30,34) |
| InChIKey | AJIIKDGMTVIBQN-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|