C21H30FN5OS — CID 5196028
N-[2-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]hexanamide (PubChem CID 5196028) has the molecular formula C21H30FN5OS and a molecular weight of 419.57 g/mol. Its IUPAC name is N-[2-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]hexanamide.
| Compound Name | N-[2-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]hexanamide |
|---|---|
| PubChem CID | 5196028 |
| Molecular Formula | C21H30FN5OS |
| Molecular Weight | 419.57 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | N-[2-[4-[3-[(4-fluorophenyl)methyl]-1,2,4-thiadiazol-5-yl]piperazin-1-yl]ethyl]hexanamide |
| SMILES | CCCCCC(=O)NCCN1CCN(c2nc(Cc3ccc(F)cc3)ns2)CC1 |
| InChI | InChI=1S/C21H30FN5OS/c1-2-3-4-5-20(28)23-10-11-26-12-14-27(15-13-26)21-24-19(25-29-21)16-17-6-8-18(22)9-7-17/h6-9H,2-5,10-16H2,1H3,(H,23,28) |
| InChIKey | QSGLUTAPCHMSGE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|