C23H29N3OS — CID 42778058
3-(1-methylindol-3-yl)-N-(2-piperidin-1-ylethyl)-3-thiophen-2-ylpropanamide (PubChem CID 42778058) has the molecular formula C23H29N3OS and a molecular weight of 395.57 g/mol. Its IUPAC name is 3-(1-methylindol-3-yl)-N-(2-piperidin-1-ylethyl)-3-thiophen-2-ylpropanamide.
| Compound Name | 3-(1-methylindol-3-yl)-N-(2-piperidin-1-ylethyl)-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 42778058 |
| Molecular Formula | C23H29N3OS |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.20 |
| IUPAC Name | 3-(1-methylindol-3-yl)-N-(2-piperidin-1-ylethyl)-3-thiophen-2-ylpropanamide |
| SMILES | Cn1cc(C(CC(=O)NCCN2CCCCC2)c2cccs2)c2ccccc21 |
| InChI | InChI=1S/C23H29N3OS/c1-25-17-20(18-8-3-4-9-21(18)25)19(22-10-7-15-28-22)16-23(27)24-11-14-26-12-5-2-6-13-26/h3-4,7-10,15,17,19H,2,5-6,11-14,16H2,1H3,(H,24,27) |
| InChIKey | SFVIUIRMOUUHAB-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 37.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |