C22H19FN2OS — CID 42774772
N-(2-fluorophenyl)-3-(1-methylindol-3-yl)-3-thiophen-2-ylpropanamide (PubChem CID 42774772) has the molecular formula C22H19FN2OS and a molecular weight of 378.47 g/mol. Its IUPAC name is N-(2-fluorophenyl)-3-(1-methylindol-3-yl)-3-thiophen-2-ylpropanamide.
| Compound Name | N-(2-fluorophenyl)-3-(1-methylindol-3-yl)-3-thiophen-2-ylpropanamide |
|---|---|
| PubChem CID | 42774772 |
| Molecular Formula | C22H19FN2OS |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | N-(2-fluorophenyl)-3-(1-methylindol-3-yl)-3-thiophen-2-ylpropanamide |
| SMILES | Cn1cc(C(CC(=O)Nc2ccccc2F)c2cccs2)c2ccccc21 |
| InChI | InChI=1S/C22H19FN2OS/c1-25-14-17(15-7-2-5-10-20(15)25)16(21-11-6-12-27-21)13-22(26)24-19-9-4-3-8-18(19)23/h2-12,14,16H,13H2,1H3,(H,24,26) |
| InChIKey | DGLUIWLYPDCWRW-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |