C16H26N2O5 — CID 42779764
N-(2-methoxyethyl)-N-[3-(2-methoxyethylamino)-3-oxopropyl]-2,5-dimethylfuran-3-carboxamide (PubChem CID 42779764) has the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-N-[3-(2-methoxyethylamino)-3-oxopropyl]-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-(2-methoxyethyl)-N-[3-(2-methoxyethylamino)-3-oxopropyl]-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 42779764 |
| Molecular Formula | C16H26N2O5 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | N-(2-methoxyethyl)-N-[3-(2-methoxyethylamino)-3-oxopropyl]-2,5-dimethylfuran-3-carboxamide |
| SMILES | COCCNC(=O)CCN(CCOC)C(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C16H26N2O5/c1-12-11-14(13(2)23-12)16(20)18(8-10-22-4)7-5-15(19)17-6-9-21-3/h11H,5-10H2,1-4H3,(H,17,19) |
| InChIKey | HIBIEQPQRPEZEX-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|