C25H27FN4O2S — CID 42780375
2-[[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide (PubChem CID 42780375) has the molecular formula C25H27FN4O2S and a molecular weight of 466.58 g/mol. Its IUPAC name is 2-[[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-[[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 42780375 |
| Molecular Formula | C25H27FN4O2S |
| Molecular Weight | 466.58 g/mol |
| Exact Mass | 466.18 |
| IUPAC Name | 2-[[(4-fluorophenyl)methyl-[2-(1H-indol-3-yl)ethyl]amino]methyl]-N-(2-methoxyethyl)-1,3-thiazole-4-carboxamide |
| SMILES | COCCNC(=O)c1csc(CN(CCc2c[nH]c3ccccc23)Cc2ccc(F)cc2)n1 |
| InChI | InChI=1S/C25H27FN4O2S/c1-32-13-11-27-25(31)23-17-33-24(29-23)16-30(15-18-6-8-20(26)9-7-18)12-10-19-14-28-22-5-3-2-4-21(19)22/h2-9,14,17,28H,10-13,15-16H2,1H3,(H,27,31) |
| InChIKey | PWOQBTKMFMYOIM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.58 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|