C21H28N2O3 — CID 42780839
N-(cyclohex-3-en-1-ylmethyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzodioxole-5-carboxamide (PubChem CID 42780839) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-(cyclohex-3-en-1-ylmethyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzodioxole-5-carboxamide.
| Compound Name | N-(cyclohex-3-en-1-ylmethyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzodioxole-5-carboxamide |
|---|---|
| PubChem CID | 42780839 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | N-(cyclohex-3-en-1-ylmethyl)-N-(2-pyrrolidin-1-ylethyl)-1,3-benzodioxole-5-carboxamide |
| SMILES | O=C(c1ccc2c(c1)OCO2)N(CCN1CCCC1)CC1CC=CCC1 |
| InChI | InChI=1S/C21H28N2O3/c24-21(18-8-9-19-20(14-18)26-16-25-19)23(13-12-22-10-4-5-11-22)15-17-6-2-1-3-7-17/h1-2,8-9,14,17H,3-7,10-13,15-16H2 |
| InChIKey | CWRQRCBWCJGGST-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|