C31H34N2O4 — CID 42785523
N-[2-(3,4-dimethoxyphenyl)ethyl]-5-(4-methoxyphenyl)-N,2-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxamide (PubChem CID 42785523) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-5-(4-methoxyphenyl)-N,2-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-(4-methoxyphenyl)-N,2-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 42785523 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-5-(4-methoxyphenyl)-N,2-dimethyl-1-(4-methylphenyl)pyrrole-3-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)N(C)CCc3ccc(OC)c(OC)c3)c(C)n2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H34N2O4/c1-21-7-12-25(13-8-21)33-22(2)27(20-28(33)24-10-14-26(35-4)15-11-24)31(34)32(3)18-17-23-9-16-29(36-5)30(19-23)37-6/h7-16,19-20H,17-18H2,1-6H3 |
| InChIKey | TZSDBGYZTNZBEC-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 52.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_B(29)', 'substructure': 'N/A'} |
|---|