C33H31BrN4O4 — CID 4278676
2-amino-4-[5-[(4-bromophenoxy)methyl]-2,4-dimethylphenyl]-7,7-dimethyl-1-(3-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile (PubChem CID 4278676) has the molecular formula C33H31BrN4O4 and a molecular weight of 627.54 g/mol. Its IUPAC name is 2-amino-4-[5-[(4-bromophenoxy)methyl]-2,4-dimethylphenyl]-7,7-dimethyl-1-(3-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile.
| Compound Name | 2-amino-4-[5-[(4-bromophenoxy)methyl]-2,4-dimethylphenyl]-7,7-dimethyl-1-(3-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 4278676 |
| Molecular Formula | C33H31BrN4O4 |
| Molecular Weight | 627.54 g/mol |
| Exact Mass | 626.15 |
| IUPAC Name | 2-amino-4-[5-[(4-bromophenoxy)methyl]-2,4-dimethylphenyl]-7,7-dimethyl-1-(3-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
| SMILES | Cc1cc(C)c(C2C(C#N)=C(N)N(c3cccc([N+](=O)[O-])c3)C3=C2C(=O)CC(C)(C)C3)cc1COc1ccc(Br)cc1 |
| InChI | InChI=1S/C33H31BrN4O4/c1-19-12-20(2)26(13-21(19)18-42-25-10-8-22(34)9-11-25)30-27(17-35)32(36)37(23-6-5-7-24(14-23)38(40)41)28-15-33(3,4)16-29(39)31(28)30/h5-14,30H,15-16,18,36H2,1-4H3 |
| InChIKey | TUUCIVZSOBRWGN-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.54 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|