C34H33ClN4O4 — CID 3454141
2-amino-4-[3-[(4-chloro-2-methylphenoxy)methyl]-2,5-dimethylphenyl]-7,7-dimethyl-1-(3-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile (PubChem CID 3454141) has the molecular formula C34H33ClN4O4 and a molecular weight of 597.12 g/mol. Its IUPAC name is 2-amino-4-[3-[(4-chloro-2-methylphenoxy)methyl]-2,5-dimethylphenyl]-7,7-dimethyl-1-(3-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile.
| Compound Name | 2-amino-4-[3-[(4-chloro-2-methylphenoxy)methyl]-2,5-dimethylphenyl]-7,7-dimethyl-1-(3-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 3454141 |
| Molecular Formula | C34H33ClN4O4 |
| Molecular Weight | 597.12 g/mol |
| Exact Mass | 596.22 |
| IUPAC Name | 2-amino-4-[3-[(4-chloro-2-methylphenoxy)methyl]-2,5-dimethylphenyl]-7,7-dimethyl-1-(3-nitrophenyl)-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
| SMILES | Cc1cc(COc2ccc(Cl)cc2C)c(C)c(C2C(C#N)=C(N)N(c3cccc([N+](=O)[O-])c3)C3=C2C(=O)CC(C)(C)C3)c1 |
| InChI | InChI=1S/C34H33ClN4O4/c1-19-11-22(18-43-30-10-9-23(35)13-20(30)2)21(3)26(12-19)31-27(17-36)33(37)38(24-7-6-8-25(14-24)39(41)42)28-15-34(4,5)16-29(40)32(28)31/h6-14,31H,15-16,18,37H2,1-5H3 |
| InChIKey | GWPFDGCKYKBNDJ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.12 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|