C33H30Cl2N4O4 — CID 4080259
2-amino-1-(2-chloro-4-nitrophenyl)-4-[3-[(2-chlorophenoxy)methyl]-2,5-dimethylphenyl]-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile (PubChem CID 4080259) has the molecular formula C33H30Cl2N4O4 and a molecular weight of 617.53 g/mol. Its IUPAC name is 2-amino-1-(2-chloro-4-nitrophenyl)-4-[3-[(2-chlorophenoxy)methyl]-2,5-dimethylphenyl]-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile.
| Compound Name | 2-amino-1-(2-chloro-4-nitrophenyl)-4-[3-[(2-chlorophenoxy)methyl]-2,5-dimethylphenyl]-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
|---|---|
| PubChem CID | 4080259 |
| Molecular Formula | C33H30Cl2N4O4 |
| Molecular Weight | 617.53 g/mol |
| Exact Mass | 616.16 |
| IUPAC Name | 2-amino-1-(2-chloro-4-nitrophenyl)-4-[3-[(2-chlorophenoxy)methyl]-2,5-dimethylphenyl]-7,7-dimethyl-5-oxo-6,8-dihydro-4H-quinoline-3-carbonitrile |
| SMILES | Cc1cc(COc2ccccc2Cl)c(C)c(C2C(C#N)=C(N)N(c3ccc([N+](=O)[O-])cc3Cl)C3=C2C(=O)CC(C)(C)C3)c1 |
| InChI | InChI=1S/C33H30Cl2N4O4/c1-18-11-20(17-43-29-8-6-5-7-24(29)34)19(2)22(12-18)30-23(16-36)32(37)38(26-10-9-21(39(41)42)13-25(26)35)27-14-33(3,4)15-28(40)31(27)30/h5-13,30H,14-15,17,37H2,1-4H3 |
| InChIKey | KPXGTBKJWKCTBV-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.53 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|