C31H27ClN4O4 — CID 3277400
2-amino-4-[3-[(2-chlorophenoxy)methyl]-2,5-dimethylphenyl]-1-(2-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 3277400) has the molecular formula C31H27ClN4O4 and a molecular weight of 555.03 g/mol. Its IUPAC name is 2-amino-4-[3-[(2-chlorophenoxy)methyl]-2,5-dimethylphenyl]-1-(2-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-4-[3-[(2-chlorophenoxy)methyl]-2,5-dimethylphenyl]-1-(2-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 3277400 |
| Molecular Formula | C31H27ClN4O4 |
| Molecular Weight | 555.03 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | 2-amino-4-[3-[(2-chlorophenoxy)methyl]-2,5-dimethylphenyl]-1-(2-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cc1cc(COc2ccccc2Cl)c(C)c(C2C(C#N)=C(N)N(c3ccccc3[N+](=O)[O-])C3=C2C(=O)CCC3)c1 |
| InChI | InChI=1S/C31H27ClN4O4/c1-18-14-20(17-40-28-13-6-3-8-23(28)32)19(2)21(15-18)29-22(16-33)31(34)35(26-11-7-12-27(37)30(26)29)24-9-4-5-10-25(24)36(38)39/h3-6,8-10,13-15,29H,7,11-12,17,34H2,1-2H3 |
| InChIKey | PLAWGUWDERGSKF-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.03 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|