C32H29FN4O5 — CID 5055690
2-amino-1-(4-fluoro-2-nitrophenyl)-4-[3-[(4-methoxyphenoxy)methyl]-2,5-dimethylphenyl]-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 5055690) has the molecular formula C32H29FN4O5 and a molecular weight of 568.61 g/mol. Its IUPAC name is 2-amino-1-(4-fluoro-2-nitrophenyl)-4-[3-[(4-methoxyphenoxy)methyl]-2,5-dimethylphenyl]-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-1-(4-fluoro-2-nitrophenyl)-4-[3-[(4-methoxyphenoxy)methyl]-2,5-dimethylphenyl]-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5055690 |
| Molecular Formula | C32H29FN4O5 |
| Molecular Weight | 568.61 g/mol |
| Exact Mass | 568.21 |
| IUPAC Name | 2-amino-1-(4-fluoro-2-nitrophenyl)-4-[3-[(4-methoxyphenoxy)methyl]-2,5-dimethylphenyl]-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | COc1ccc(OCc2cc(C)cc(C3C(C#N)=C(N)N(c4ccc(F)cc4[N+](=O)[O-])C4=C3C(=O)CCC4)c2C)cc1 |
| InChI | InChI=1S/C32H29FN4O5/c1-18-13-20(17-42-23-10-8-22(41-3)9-11-23)19(2)24(14-18)30-25(16-34)32(35)36(27-5-4-6-29(38)31(27)30)26-12-7-21(33)15-28(26)37(39)40/h7-15,30H,4-6,17,35H2,1-3H3 |
| InChIKey | BYDDZJQRRBFYMK-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 131.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.61 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|