C32H28ClFN4O4 — CID 3383362
2-amino-4-[5-[(4-chloro-2-methylphenoxy)methyl]-2,4-dimethylphenyl]-1-(4-fluoro-2-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 3383362) has the molecular formula C32H28ClFN4O4 and a molecular weight of 587.05 g/mol. Its IUPAC name is 2-amino-4-[5-[(4-chloro-2-methylphenoxy)methyl]-2,4-dimethylphenyl]-1-(4-fluoro-2-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-4-[5-[(4-chloro-2-methylphenoxy)methyl]-2,4-dimethylphenyl]-1-(4-fluoro-2-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 3383362 |
| Molecular Formula | C32H28ClFN4O4 |
| Molecular Weight | 587.05 g/mol |
| Exact Mass | 586.18 |
| IUPAC Name | 2-amino-4-[5-[(4-chloro-2-methylphenoxy)methyl]-2,4-dimethylphenyl]-1-(4-fluoro-2-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cc1cc(C)c(C2C(C#N)=C(N)N(c3ccc(F)cc3[N+](=O)[O-])C3=C2C(=O)CCC3)cc1COc1ccc(Cl)cc1C |
| InChI | InChI=1S/C32H28ClFN4O4/c1-17-11-18(2)23(13-20(17)16-42-29-10-7-21(33)12-19(29)3)30-24(15-35)32(36)37(26-5-4-6-28(39)31(26)30)25-9-8-22(34)14-27(25)38(40)41/h7-14,30H,4-6,16,36H2,1-3H3 |
| InChIKey | TTWCRDRMNFMPJU-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.05 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|