C31H26BrClN4O4 — CID 4653859
2-amino-4-[5-[(2-bromophenoxy)methyl]-2,4-dimethylphenyl]-1-(4-chloro-3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 4653859) has the molecular formula C31H26BrClN4O4 and a molecular weight of 633.93 g/mol. Its IUPAC name is 2-amino-4-[5-[(2-bromophenoxy)methyl]-2,4-dimethylphenyl]-1-(4-chloro-3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-4-[5-[(2-bromophenoxy)methyl]-2,4-dimethylphenyl]-1-(4-chloro-3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 4653859 |
| Molecular Formula | C31H26BrClN4O4 |
| Molecular Weight | 633.93 g/mol |
| Exact Mass | 632.08 |
| IUPAC Name | 2-amino-4-[5-[(2-bromophenoxy)methyl]-2,4-dimethylphenyl]-1-(4-chloro-3-nitrophenyl)-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cc1cc(C)c(C2C(C#N)=C(N)N(c3ccc(Cl)c([N+](=O)[O-])c3)C3=C2C(=O)CCC3)cc1COc1ccccc1Br |
| InChI | InChI=1S/C31H26BrClN4O4/c1-17-12-18(2)21(13-19(17)16-41-28-9-4-3-6-23(28)32)29-22(15-34)31(35)36(25-7-5-8-27(38)30(25)29)20-10-11-24(33)26(14-20)37(39)40/h3-4,6,9-14,29H,5,7-8,16,35H2,1-2H3 |
| InChIKey | GWTDGWICCWATIF-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.93 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|