C32H29ClN4O3S — CID 5081878
2-amino-1-(4-chloro-3-nitrophenyl)-4-[2,5-dimethyl-3-[(2-methylphenyl)sulfanylmethyl]phenyl]-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 5081878) has the molecular formula C32H29ClN4O3S and a molecular weight of 585.13 g/mol. Its IUPAC name is 2-amino-1-(4-chloro-3-nitrophenyl)-4-[2,5-dimethyl-3-[(2-methylphenyl)sulfanylmethyl]phenyl]-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-1-(4-chloro-3-nitrophenyl)-4-[2,5-dimethyl-3-[(2-methylphenyl)sulfanylmethyl]phenyl]-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5081878 |
| Molecular Formula | C32H29ClN4O3S |
| Molecular Weight | 585.13 g/mol |
| Exact Mass | 584.16 |
| IUPAC Name | 2-amino-1-(4-chloro-3-nitrophenyl)-4-[2,5-dimethyl-3-[(2-methylphenyl)sulfanylmethyl]phenyl]-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cc1cc(CSc2ccccc2C)c(C)c(C2C(C#N)=C(N)N(c3ccc(Cl)c([N+](=O)[O-])c3)C3=C2C(=O)CCC3)c1 |
| InChI | InChI=1S/C32H29ClN4O3S/c1-18-13-21(17-41-29-10-5-4-7-19(29)2)20(3)23(14-18)30-24(16-34)32(35)36(26-8-6-9-28(38)31(26)30)22-11-12-25(33)27(15-22)37(39)40/h4-5,7,10-15,30H,6,8-9,17,35H2,1-3H3 |
| InChIKey | AXIPNBWMJKSSQL-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 113.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.13 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|