C31H26Cl2N4O4 — CID 5139516
2-amino-1-(4-chloro-3-nitrophenyl)-4-[5-[(4-chlorophenoxy)methyl]-2,4-dimethylphenyl]-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile (PubChem CID 5139516) has the molecular formula C31H26Cl2N4O4 and a molecular weight of 589.48 g/mol. Its IUPAC name is 2-amino-1-(4-chloro-3-nitrophenyl)-4-[5-[(4-chlorophenoxy)methyl]-2,4-dimethylphenyl]-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile.
| Compound Name | 2-amino-1-(4-chloro-3-nitrophenyl)-4-[5-[(4-chlorophenoxy)methyl]-2,4-dimethylphenyl]-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
|---|---|
| PubChem CID | 5139516 |
| Molecular Formula | C31H26Cl2N4O4 |
| Molecular Weight | 589.48 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | 2-amino-1-(4-chloro-3-nitrophenyl)-4-[5-[(4-chlorophenoxy)methyl]-2,4-dimethylphenyl]-5-oxo-4,6,7,8-tetrahydroquinoline-3-carbonitrile |
| SMILES | Cc1cc(C)c(C2C(C#N)=C(N)N(c3ccc(Cl)c([N+](=O)[O-])c3)C3=C2C(=O)CCC3)cc1COc1ccc(Cl)cc1 |
| InChI | InChI=1S/C31H26Cl2N4O4/c1-17-12-18(2)23(13-19(17)16-41-22-9-6-20(32)7-10-22)29-24(15-34)31(35)36(26-4-3-5-28(38)30(26)29)21-8-11-25(33)27(14-21)37(39)40/h6-14,29H,3-5,16,35H2,1-2H3 |
| InChIKey | AIQJBZWDZSREOY-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 122.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.48 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|