C26H32FN3O3 — CID 42787109
5-[[2-[[(4-fluorobenzoyl)-propylamino]methyl]pyrrol-1-yl]methyl]-N-pentylfuran-2-carboxamide (PubChem CID 42787109) has the molecular formula C26H32FN3O3 and a molecular weight of 453.56 g/mol. Its IUPAC name is 5-[[2-[[(4-fluorobenzoyl)-propylamino]methyl]pyrrol-1-yl]methyl]-N-pentylfuran-2-carboxamide.
| Compound Name | 5-[[2-[[(4-fluorobenzoyl)-propylamino]methyl]pyrrol-1-yl]methyl]-N-pentylfuran-2-carboxamide |
|---|---|
| PubChem CID | 42787109 |
| Molecular Formula | C26H32FN3O3 |
| Molecular Weight | 453.56 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 5-[[2-[[(4-fluorobenzoyl)-propylamino]methyl]pyrrol-1-yl]methyl]-N-pentylfuran-2-carboxamide |
| SMILES | CCCCCNC(=O)c1ccc(Cn2cccc2CN(CCC)C(=O)c2ccc(F)cc2)o1 |
| InChI | InChI=1S/C26H32FN3O3/c1-3-5-6-15-28-25(31)24-14-13-23(33-24)19-29-17-7-8-22(29)18-30(16-4-2)26(32)20-9-11-21(27)12-10-20/h7-14,17H,3-6,15-16,18-19H2,1-2H3,(H,28,31) |
| InChIKey | ZFMDUKKYKJZQNV-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.56 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|