C24H35N3O4 — CID 7418269
5-[[2-[[cyclopentanecarbonyl(propyl)amino]methyl]pyrrol-1-yl]methyl]-N-(3-methoxypropyl)furan-2-carboxamide (PubChem CID 7418269) has the molecular formula C24H35N3O4 and a molecular weight of 429.56 g/mol. Its IUPAC name is 5-[[2-[[cyclopentanecarbonyl(propyl)amino]methyl]pyrrol-1-yl]methyl]-N-(3-methoxypropyl)furan-2-carboxamide.
| Compound Name | 5-[[2-[[cyclopentanecarbonyl(propyl)amino]methyl]pyrrol-1-yl]methyl]-N-(3-methoxypropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 7418269 |
| Molecular Formula | C24H35N3O4 |
| Molecular Weight | 429.56 g/mol |
| Exact Mass | 429.26 |
| IUPAC Name | 5-[[2-[[cyclopentanecarbonyl(propyl)amino]methyl]pyrrol-1-yl]methyl]-N-(3-methoxypropyl)furan-2-carboxamide |
| SMILES | CCCN(Cc1cccn1Cc1ccc(C(=O)NCCCOC)o1)C(=O)C1CCCC1 |
| InChI | InChI=1S/C24H35N3O4/c1-3-14-27(24(29)19-8-4-5-9-19)17-20-10-6-15-26(20)18-21-11-12-22(31-21)23(28)25-13-7-16-30-2/h6,10-12,15,19H,3-5,7-9,13-14,16-18H2,1-2H3,(H,25,28) |
| InChIKey | YIGCDJHAHGFPFO-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 76.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|