C23H25N3O3 — CID 42788366
methyl 2-[1H-imidazol-2-ylmethyl(4-phenylbutan-2-yl)carbamoyl]benzoate (PubChem CID 42788366) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is methyl 2-[1H-imidazol-2-ylmethyl(4-phenylbutan-2-yl)carbamoyl]benzoate.
| Compound Name | methyl 2-[1H-imidazol-2-ylmethyl(4-phenylbutan-2-yl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 42788366 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | methyl 2-[1H-imidazol-2-ylmethyl(4-phenylbutan-2-yl)carbamoyl]benzoate |
| SMILES | COC(=O)c1ccccc1C(=O)N(Cc1ncc[nH]1)C(C)CCc1ccccc1 |
| InChI | InChI=1S/C23H25N3O3/c1-17(12-13-18-8-4-3-5-9-18)26(16-21-24-14-15-25-21)22(27)19-10-6-7-11-20(19)23(28)29-2/h3-11,14-15,17H,12-13,16H2,1-2H3,(H,24,25) |
| InChIKey | NIIZFKXBGRZXLR-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |