C10H6Cl2N2O3 — CID 42788974
2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid (PubChem CID 42788974) has the molecular formula C10H6Cl2N2O3 and a molecular weight of 273.07 g/mol. Its IUPAC name is 2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid.
| Compound Name | 2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid |
|---|---|
| PubChem CID | 42788974 |
| Molecular Formula | C10H6Cl2N2O3 |
| Molecular Weight | 273.07 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid |
| SMILES | O=C(O)Cc1noc(-c2ccc(Cl)cc2Cl)n1 |
| InChI | InChI=1S/C10H6Cl2N2O3/c11-5-1-2-6(7(12)3-5)10-13-8(14-17-10)4-9(15)16/h1-3H,4H2,(H,15,16) |
| InChIKey | WRBYTZPKDIPYFT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.07 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |