2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid

C10H6Cl2N2O3 — CID 42788974

IUPAC2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid
SMILESO=C(O)Cc1noc(-c2ccc(Cl)cc2Cl)n1
InChIInChI=1S/C10H6Cl2N2O3/c11-5-1-2-6(7(12)3-5)10-13-8(14-17-10)4-9(15)16/h1-3H,4H2,(H,15,16)
InChIKeyWRBYTZPKDIPYFT-UHFFFAOYSA-N
MW273.07 g/mol
LogP2.67
Rot. Bonds3

About 2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid

2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid (PubChem CID 42788974) has the molecular formula C10H6Cl2N2O3 and a molecular weight of 273.07 g/mol. Its IUPAC name is 2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid.

Molecular Properties

Compound Name2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid
PubChem CID42788974
Molecular FormulaC10H6Cl2N2O3
Molecular Weight273.07 g/mol
Exact Mass271.98
IUPAC Name2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid
SMILESO=C(O)Cc1noc(-c2ccc(Cl)cc2Cl)n1
InChIInChI=1S/C10H6Cl2N2O3/c11-5-1-2-6(7(12)3-5)10-13-8(14-17-10)4-9(15)16/h1-3H,4H2,(H,15,16)
InChIKeyWRBYTZPKDIPYFT-UHFFFAOYSA-N
XLogP2.67
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.07
LogP ≤ 52.67
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid?
The IUPAC name of 2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid (CID 42788974) is 2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid.
What is the SMILES notation for 2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid?
The canonical SMILES for 2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid is O=C(O)Cc1noc(-c2ccc(Cl)cc2Cl)n1.
What is the InChIKey of 2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid?
The InChIKey is WRBYTZPKDIPYFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6Cl2N2O3/c11-5-1-2-6(7(12)3-5)10-13-8(14-17-10)4-9(15)16/h1-3H,4H2,(H,15,16).
What are the key properties of 2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid?
2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid has a molecular weight of 273.07 g/mol, XLogP of 2.67, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-(2,4-dichlorophenyl)-1,2,4-oxadiazol-3-yl]acetic acid is sourced from PubChem (CID 42788974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).