C26H38N4O4 — CID 42789760
1-[(3-methoxyphenyl)methyl]-3,5-dimethyl-4-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyrrole-2-carboxamide (PubChem CID 42789760) has the molecular formula C26H38N4O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is 1-[(3-methoxyphenyl)methyl]-3,5-dimethyl-4-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyrrole-2-carboxamide.
| Compound Name | 1-[(3-methoxyphenyl)methyl]-3,5-dimethyl-4-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 42789760 |
| Molecular Formula | C26H38N4O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.29 |
| IUPAC Name | 1-[(3-methoxyphenyl)methyl]-3,5-dimethyl-4-morpholin-4-yl-N-(3-morpholin-4-ylpropyl)pyrrole-2-carboxamide |
| SMILES | COc1cccc(Cn2c(C)c(N3CCOCC3)c(C)c2C(=O)NCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C26H38N4O4/c1-20-24(29-12-16-34-17-13-29)21(2)30(19-22-6-4-7-23(18-22)32-3)25(20)26(31)27-8-5-9-28-10-14-33-15-11-28/h4,6-7,18H,5,8-17,19H2,1-3H3,(H,27,31) |
| InChIKey | LIMJPNGDSKKRPT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 68.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|