C34H35N5O3S2 — CID 42792279
2-[(3-benzyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanylmethyl]-N-(1-benzylpiperidin-4-yl)-1,3-oxazole-4-carboxamide (PubChem CID 42792279) has the molecular formula C34H35N5O3S2 and a molecular weight of 625.82 g/mol. Its IUPAC name is 2-[(3-benzyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanylmethyl]-N-(1-benzylpiperidin-4-yl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[(3-benzyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanylmethyl]-N-(1-benzylpiperidin-4-yl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 42792279 |
| Molecular Formula | C34H35N5O3S2 |
| Molecular Weight | 625.82 g/mol |
| Exact Mass | 625.22 |
| IUPAC Name | 2-[(3-benzyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanylmethyl]-N-(1-benzylpiperidin-4-yl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NC1CCN(Cc2ccccc2)CC1)c1coc(CSc2nc3sc4c(c3c(=O)n2Cc2ccccc2)CCCC4)n1 |
| InChI | InChI=1S/C34H35N5O3S2/c40-31(35-25-15-17-38(18-16-25)19-23-9-3-1-4-10-23)27-21-42-29(36-27)22-43-34-37-32-30(26-13-7-8-14-28(26)44-32)33(41)39(34)20-24-11-5-2-6-12-24/h1-6,9-12,21,25H,7-8,13-20,22H2,(H,35,40) |
| InChIKey | KPCQXVURWAJHHT-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 93.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.82 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het_65_pyridone_A(3)', 'substructure': 'N/A'} |
|---|