C26H28N4O4S2 — CID 42793846
2-[(3-cyclohexyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanylmethyl]-N-(furan-2-ylmethyl)-1,3-oxazole-4-carboxamide (PubChem CID 42793846) has the molecular formula C26H28N4O4S2 and a molecular weight of 524.67 g/mol. Its IUPAC name is 2-[(3-cyclohexyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanylmethyl]-N-(furan-2-ylmethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-[(3-cyclohexyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanylmethyl]-N-(furan-2-ylmethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 42793846 |
| Molecular Formula | C26H28N4O4S2 |
| Molecular Weight | 524.67 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | 2-[(3-cyclohexyl-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl)sulfanylmethyl]-N-(furan-2-ylmethyl)-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCc1ccco1)c1coc(CSc2nc3sc4c(c3c(=O)n2C2CCCCC2)CCCC4)n1 |
| InChI | InChI=1S/C26H28N4O4S2/c31-23(27-13-17-9-6-12-33-17)19-14-34-21(28-19)15-35-26-29-24-22(18-10-4-5-11-20(18)36-24)25(32)30(26)16-7-2-1-3-8-16/h6,9,12,14,16H,1-5,7-8,10-11,13,15H2,(H,27,31) |
| InChIKey | IVXJDUMKNQIBAV-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 103.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.67 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |