C27H26Cl2N4O3S2 — CID 42794586
4-(1-benzylpiperidin-4-yl)-11-(2,5-dichlorophenyl)sulfonyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one (PubChem CID 42794586) has the molecular formula C27H26Cl2N4O3S2 and a molecular weight of 589.57 g/mol. Its IUPAC name is 4-(1-benzylpiperidin-4-yl)-11-(2,5-dichlorophenyl)sulfonyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one.
| Compound Name | 4-(1-benzylpiperidin-4-yl)-11-(2,5-dichlorophenyl)sulfonyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
|---|---|
| PubChem CID | 42794586 |
| Molecular Formula | C27H26Cl2N4O3S2 |
| Molecular Weight | 589.57 g/mol |
| Exact Mass | 588.08 |
| IUPAC Name | 4-(1-benzylpiperidin-4-yl)-11-(2,5-dichlorophenyl)sulfonyl-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),5-trien-3-one |
| SMILES | O=c1c2c3c(sc2ncn1C1CCN(Cc2ccccc2)CC1)CN(S(=O)(=O)c1cc(Cl)ccc1Cl)CC3 |
| InChI | InChI=1S/C27H26Cl2N4O3S2/c28-19-6-7-22(29)24(14-19)38(35,36)32-13-10-21-23(16-32)37-26-25(21)27(34)33(17-30-26)20-8-11-31(12-9-20)15-18-4-2-1-3-5-18/h1-7,14,17,20H,8-13,15-16H2 |
| InChIKey | QICPEHVZQHGPDC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |