C22H30FN3O2 — CID 42794798
1-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-prop-2-enylamino]-3-morpholin-4-ylpropan-2-ol (PubChem CID 42794798) has the molecular formula C22H30FN3O2 and a molecular weight of 387.50 g/mol. Its IUPAC name is 1-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-prop-2-enylamino]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | 1-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-prop-2-enylamino]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 42794798 |
| Molecular Formula | C22H30FN3O2 |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | 1-[[1-[(2-fluorophenyl)methyl]pyrrol-2-yl]methyl-prop-2-enylamino]-3-morpholin-4-ylpropan-2-ol |
| SMILES | C=CCN(Cc1cccn1Cc1ccccc1F)CC(O)CN1CCOCC1 |
| InChI | InChI=1S/C22H30FN3O2/c1-2-9-25(18-21(27)17-24-11-13-28-14-12-24)16-20-7-5-10-26(20)15-19-6-3-4-8-22(19)23/h2-8,10,21,27H,1,9,11-18H2 |
| InChIKey | SFXHJXPCVNUGGV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 40.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|