C25H32N2O2 — CID 42794939
2-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl-(2-methylpropyl)amino]-1-phenylethanol (PubChem CID 42794939) has the molecular formula C25H32N2O2 and a molecular weight of 392.54 g/mol. Its IUPAC name is 2-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl-(2-methylpropyl)amino]-1-phenylethanol.
| Compound Name | 2-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl-(2-methylpropyl)amino]-1-phenylethanol |
|---|---|
| PubChem CID | 42794939 |
| Molecular Formula | C25H32N2O2 |
| Molecular Weight | 392.54 g/mol |
| Exact Mass | 392.25 |
| IUPAC Name | 2-[[1-[(3-methoxyphenyl)methyl]pyrrol-2-yl]methyl-(2-methylpropyl)amino]-1-phenylethanol |
| SMILES | COc1cccc(Cn2cccc2CN(CC(C)C)CC(O)c2ccccc2)c1 |
| InChI | InChI=1S/C25H32N2O2/c1-20(2)16-26(19-25(28)22-10-5-4-6-11-22)18-23-12-8-14-27(23)17-21-9-7-13-24(15-21)29-3/h4-15,20,25,28H,16-19H2,1-3H3 |
| InChIKey | TXJUHLITOQDRJY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 37.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.54 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |