C16H20N2O4S — CID 42795367
methyl 2-[5-(hydroxymethyl)-1-[(2-methoxyphenyl)methyl]imidazol-2-yl]sulfanylpropanoate (PubChem CID 42795367) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is methyl 2-[5-(hydroxymethyl)-1-[(2-methoxyphenyl)methyl]imidazol-2-yl]sulfanylpropanoate.
| Compound Name | methyl 2-[5-(hydroxymethyl)-1-[(2-methoxyphenyl)methyl]imidazol-2-yl]sulfanylpropanoate |
|---|---|
| PubChem CID | 42795367 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | methyl 2-[5-(hydroxymethyl)-1-[(2-methoxyphenyl)methyl]imidazol-2-yl]sulfanylpropanoate |
| SMILES | COC(=O)C(C)Sc1ncc(CO)n1Cc1ccccc1OC |
| InChI | InChI=1S/C16H20N2O4S/c1-11(15(20)22-3)23-16-17-8-13(10-19)18(16)9-12-6-4-5-7-14(12)21-2/h4-8,11,19H,9-10H2,1-3H3 |
| InChIKey | DIKBUEMOEIFCQU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |