C16H19F3N2OS — CID 42795463
[3-butyl-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]imidazol-4-yl]methanol (PubChem CID 42795463) has the molecular formula C16H19F3N2OS and a molecular weight of 344.40 g/mol. Its IUPAC name is [3-butyl-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]imidazol-4-yl]methanol.
| Compound Name | [3-butyl-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]imidazol-4-yl]methanol |
|---|---|
| PubChem CID | 42795463 |
| Molecular Formula | C16H19F3N2OS |
| Molecular Weight | 344.40 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | [3-butyl-2-[[3-(trifluoromethyl)phenyl]methylsulfanyl]imidazol-4-yl]methanol |
| SMILES | CCCCn1c(CO)cnc1SCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F3N2OS/c1-2-3-7-21-14(10-22)9-20-15(21)23-11-12-5-4-6-13(8-12)16(17,18)19/h4-6,8-9,22H,2-3,7,10-11H2,1H3 |
| InChIKey | STMPITSLDQZDJW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |