C22H24F3N3OS — CID 19732592
3-(4-butoxyphenyl)-4-ethyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazole (PubChem CID 19732592) has the molecular formula C22H24F3N3OS and a molecular weight of 435.52 g/mol. Its IUPAC name is 3-(4-butoxyphenyl)-4-ethyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazole.
| Compound Name | 3-(4-butoxyphenyl)-4-ethyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazole |
|---|---|
| PubChem CID | 19732592 |
| Molecular Formula | C22H24F3N3OS |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.16 |
| IUPAC Name | 3-(4-butoxyphenyl)-4-ethyl-5-[[3-(trifluoromethyl)phenyl]methylsulfanyl]-1,2,4-triazole |
| SMILES | CCCCOc1ccc(-c2nnc(SCc3cccc(C(F)(F)F)c3)n2CC)cc1 |
| InChI | InChI=1S/C22H24F3N3OS/c1-3-5-13-29-19-11-9-17(10-12-19)20-26-27-21(28(20)4-2)30-15-16-7-6-8-18(14-16)22(23,24)25/h6-12,14H,3-5,13,15H2,1-2H3 |
| InChIKey | LEBWLNVEUMUDJH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 39.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|