C15H22N2OS — CID 42795822
5-methyl-3-[3-(methylamino)propyl]-2-(3-methylphenyl)-1,3-thiazolidin-4-one (PubChem CID 42795822) has the molecular formula C15H22N2OS and a molecular weight of 278.42 g/mol. Its IUPAC name is 5-methyl-3-[3-(methylamino)propyl]-2-(3-methylphenyl)-1,3-thiazolidin-4-one.
| Compound Name | 5-methyl-3-[3-(methylamino)propyl]-2-(3-methylphenyl)-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 42795822 |
| Molecular Formula | C15H22N2OS |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 5-methyl-3-[3-(methylamino)propyl]-2-(3-methylphenyl)-1,3-thiazolidin-4-one |
| SMILES | CNCCCN1C(=O)C(C)SC1c1cccc(C)c1 |
| InChI | InChI=1S/C15H22N2OS/c1-11-6-4-7-13(10-11)15-17(9-5-8-16-3)14(18)12(2)19-15/h4,6-7,10,12,15-16H,5,8-9H2,1-3H3 |
| InChIKey | XQAHOACRAIYOLO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|