C33H45N3O3 — CID 42796128
2-[butyl-(2-hydroxy-3-prop-2-ynoxypropyl)amino]-N-[(4-tert-butylphenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 42796128) has the molecular formula C33H45N3O3 and a molecular weight of 531.74 g/mol. Its IUPAC name is 2-[butyl-(2-hydroxy-3-prop-2-ynoxypropyl)amino]-N-[(4-tert-butylphenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-[butyl-(2-hydroxy-3-prop-2-ynoxypropyl)amino]-N-[(4-tert-butylphenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 42796128 |
| Molecular Formula | C33H45N3O3 |
| Molecular Weight | 531.74 g/mol |
| Exact Mass | 531.35 |
| IUPAC Name | 2-[butyl-(2-hydroxy-3-prop-2-ynoxypropyl)amino]-N-[(4-tert-butylphenyl)methyl]-N-[2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | C#CCOCC(O)CN(CCCC)CC(=O)N(CCc1c[nH]c2ccccc12)Cc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C33H45N3O3/c1-6-8-18-35(23-29(37)25-39-20-7-2)24-32(38)36(22-26-13-15-28(16-14-26)33(3,4)5)19-17-27-21-34-31-12-10-9-11-30(27)31/h2,9-16,21,29,34,37H,6,8,17-20,22-25H2,1,3-5H3 |
| InChIKey | IUBUEVMULCMGSP-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 68.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.74 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|