C25H24N2O3 — CID 42796826
ethyl 2-[[4-phenyl-N-(pyridine-4-carbonyl)anilino]methyl]cyclopropane-1-carboxylate (PubChem CID 42796826) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is ethyl 2-[[4-phenyl-N-(pyridine-4-carbonyl)anilino]methyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-[[4-phenyl-N-(pyridine-4-carbonyl)anilino]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 42796826 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | ethyl 2-[[4-phenyl-N-(pyridine-4-carbonyl)anilino]methyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1CC1CN(C(=O)c1ccncc1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2O3/c1-2-30-25(29)23-16-21(23)17-27(24(28)20-12-14-26-15-13-20)22-10-8-19(9-11-22)18-6-4-3-5-7-18/h3-15,21,23H,2,16-17H2,1H3 |
| InChIKey | QYLJWNYLFOICSI-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |