C29H26N2O3 — CID 42796828
ethyl 2-[[4-phenyl-N-(quinoline-4-carbonyl)anilino]methyl]cyclopropane-1-carboxylate (PubChem CID 42796828) has the molecular formula C29H26N2O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is ethyl 2-[[4-phenyl-N-(quinoline-4-carbonyl)anilino]methyl]cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-[[4-phenyl-N-(quinoline-4-carbonyl)anilino]methyl]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 42796828 |
| Molecular Formula | C29H26N2O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | ethyl 2-[[4-phenyl-N-(quinoline-4-carbonyl)anilino]methyl]cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C1CC1CN(C(=O)c1ccnc2ccccc12)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C29H26N2O3/c1-2-34-29(33)26-18-22(26)19-31(23-14-12-21(13-15-23)20-8-4-3-5-9-20)28(32)25-16-17-30-27-11-7-6-10-24(25)27/h3-17,22,26H,2,18-19H2,1H3 |
| InChIKey | VXLFZFUPLMDFPO-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |