C15H15NO2 — CID 90221399
ethyl (1S)-2-isoquinolin-1-ylcyclopropane-1-carboxylate (PubChem CID 90221399) has the molecular formula C15H15NO2 and a molecular weight of 241.29 g/mol. Its IUPAC name is ethyl (1S)-2-isoquinolin-1-ylcyclopropane-1-carboxylate.
| Compound Name | ethyl (1S)-2-isoquinolin-1-ylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 90221399 |
| Molecular Formula | C15H15NO2 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | ethyl (1S)-2-isoquinolin-1-ylcyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1CC1c1nccc2ccccc12 |
| InChI | InChI=1S/C15H15NO2/c1-2-18-15(17)13-9-12(13)14-11-6-4-3-5-10(11)7-8-16-14/h3-8,12-13H,2,9H2,1H3/t12?,13-/m0/s1 |
| InChIKey | SZPDHYNZFKRCBN-ABLWVSNPSA-N |
| XLogP | 2.90 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |