C20H19NO2S2 — CID 175316439
ethyl 2-(5-quinolin-4-ylthiophen-2-yl)sulfanylcyclobutane-1-carboxylate (PubChem CID 175316439) has the molecular formula C20H19NO2S2 and a molecular weight of 369.51 g/mol. Its IUPAC name is ethyl 2-(5-quinolin-4-ylthiophen-2-yl)sulfanylcyclobutane-1-carboxylate.
| Compound Name | ethyl 2-(5-quinolin-4-ylthiophen-2-yl)sulfanylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 175316439 |
| Molecular Formula | C20H19NO2S2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | ethyl 2-(5-quinolin-4-ylthiophen-2-yl)sulfanylcyclobutane-1-carboxylate |
| SMILES | CCOC(=O)C1CCC1Sc1ccc(-c2ccnc3ccccc23)s1 |
| InChI | InChI=1S/C20H19NO2S2/c1-2-23-20(22)15-7-8-18(15)25-19-10-9-17(24-19)14-11-12-21-16-6-4-3-5-13(14)16/h3-6,9-12,15,18H,2,7-8H2,1H3 |
| InChIKey | BWGAGDFPRCTKNT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |