C24H27N3O3S — CID 42797400
1-[2-methyl-4-[6-(2-methylprop-2-enyl)thieno[2,3-b]pyrrole-5-carbonyl]piperazin-1-yl]-2-phenoxyethanone (PubChem CID 42797400) has the molecular formula C24H27N3O3S and a molecular weight of 437.57 g/mol. Its IUPAC name is 1-[2-methyl-4-[6-(2-methylprop-2-enyl)thieno[2,3-b]pyrrole-5-carbonyl]piperazin-1-yl]-2-phenoxyethanone.
| Compound Name | 1-[2-methyl-4-[6-(2-methylprop-2-enyl)thieno[2,3-b]pyrrole-5-carbonyl]piperazin-1-yl]-2-phenoxyethanone |
|---|---|
| PubChem CID | 42797400 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 1-[2-methyl-4-[6-(2-methylprop-2-enyl)thieno[2,3-b]pyrrole-5-carbonyl]piperazin-1-yl]-2-phenoxyethanone |
| SMILES | C=C(C)Cn1c(C(=O)N2CCN(C(=O)COc3ccccc3)C(C)C2)cc2ccsc21 |
| InChI | InChI=1S/C24H27N3O3S/c1-17(2)14-27-21(13-19-9-12-31-24(19)27)23(29)25-10-11-26(18(3)15-25)22(28)16-30-20-7-5-4-6-8-20/h4-9,12-13,18H,1,10-11,14-16H2,2-3H3 |
| InChIKey | REUMYKBHKAFYJK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 54.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|