C26H30N4O4S — CID 42797470
ethyl 4-[[2-methyl-4-[6-(2-methylprop-2-enyl)thieno[2,3-b]pyrrole-5-carbonyl]piperazine-1-carbonyl]amino]benzoate (PubChem CID 42797470) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is ethyl 4-[[2-methyl-4-[6-(2-methylprop-2-enyl)thieno[2,3-b]pyrrole-5-carbonyl]piperazine-1-carbonyl]amino]benzoate.
| Compound Name | ethyl 4-[[2-methyl-4-[6-(2-methylprop-2-enyl)thieno[2,3-b]pyrrole-5-carbonyl]piperazine-1-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 42797470 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | ethyl 4-[[2-methyl-4-[6-(2-methylprop-2-enyl)thieno[2,3-b]pyrrole-5-carbonyl]piperazine-1-carbonyl]amino]benzoate |
| SMILES | C=C(C)Cn1c(C(=O)N2CCN(C(=O)Nc3ccc(C(=O)OCC)cc3)C(C)C2)cc2ccsc21 |
| InChI | InChI=1S/C26H30N4O4S/c1-5-34-25(32)19-6-8-21(9-7-19)27-26(33)29-12-11-28(16-18(29)4)23(31)22-14-20-10-13-35-24(20)30(22)15-17(2)3/h6-10,13-14,18H,2,5,11-12,15-16H2,1,3-4H3,(H,27,33) |
| InChIKey | OURLCAFTKIWGBM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|