C17H14ClN5O4 — CID 42797828
1-[1-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-(4-nitrophenyl)urea (PubChem CID 42797828) has the molecular formula C17H14ClN5O4 and a molecular weight of 387.78 g/mol. Its IUPAC name is 1-[1-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-(4-nitrophenyl)urea.
| Compound Name | 1-[1-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-(4-nitrophenyl)urea |
|---|---|
| PubChem CID | 42797828 |
| Molecular Formula | C17H14ClN5O4 |
| Molecular Weight | 387.78 g/mol |
| Exact Mass | 387.07 |
| IUPAC Name | 1-[1-[3-(3-chlorophenyl)-1,2,4-oxadiazol-5-yl]ethyl]-3-(4-nitrophenyl)urea |
| SMILES | CC(NC(=O)Nc1ccc([N+](=O)[O-])cc1)c1nc(-c2cccc(Cl)c2)no1 |
| InChI | InChI=1S/C17H14ClN5O4/c1-10(16-21-15(22-27-16)11-3-2-4-12(18)9-11)19-17(24)20-13-5-7-14(8-6-13)23(25)26/h2-10H,1H3,(H2,19,20,24) |
| InChIKey | UXTPFKDCPPGDDQ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 123.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.78 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|