C22H26N2O7S — CID 4279924
methyl 2-[[1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate (PubChem CID 4279924) has the molecular formula C22H26N2O7S and a molecular weight of 462.52 g/mol. Its IUPAC name is methyl 2-[[1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate.
| Compound Name | methyl 2-[[1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 4279924 |
| Molecular Formula | C22H26N2O7S |
| Molecular Weight | 462.52 g/mol |
| Exact Mass | 462.15 |
| IUPAC Name | methyl 2-[[1-(3,4-dimethoxyphenyl)sulfonylpiperidine-3-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)C1CCCN(S(=O)(=O)c2ccc(OC)c(OC)c2)C1 |
| InChI | InChI=1S/C22H26N2O7S/c1-29-19-11-10-16(13-20(19)30-2)32(27,28)24-12-6-7-15(14-24)21(25)23-18-9-5-4-8-17(18)22(26)31-3/h4-5,8-11,13,15H,6-7,12,14H2,1-3H3,(H,23,25) |
| InChIKey | BVRSMDQKYFDPMX-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.52 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |