C16H21ClN4OS — CID 42799781
2-chloro-1-[4-(2-ethyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanone (PubChem CID 42799781) has the molecular formula C16H21ClN4OS and a molecular weight of 352.89 g/mol. Its IUPAC name is 2-chloro-1-[4-(2-ethyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanone.
| Compound Name | 2-chloro-1-[4-(2-ethyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 42799781 |
| Molecular Formula | C16H21ClN4OS |
| Molecular Weight | 352.89 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 2-chloro-1-[4-(2-ethyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]ethanone |
| SMILES | CCc1nc(N2CCN(C(=O)CCl)CC2)c2c(C)c(C)sc2n1 |
| InChI | InChI=1S/C16H21ClN4OS/c1-4-12-18-15(14-10(2)11(3)23-16(14)19-12)21-7-5-20(6-8-21)13(22)9-17/h4-9H2,1-3H3 |
| InChIKey | OJYUSOIINZGXJN-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.89 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|