C23H27ClN4OS — CID 42799722
2-chloro-1-[4-[5,6-dimethyl-2-(2-phenylethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]propan-1-one (PubChem CID 42799722) has the molecular formula C23H27ClN4OS and a molecular weight of 443.02 g/mol. Its IUPAC name is 2-chloro-1-[4-[5,6-dimethyl-2-(2-phenylethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]propan-1-one.
| Compound Name | 2-chloro-1-[4-[5,6-dimethyl-2-(2-phenylethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 42799722 |
| Molecular Formula | C23H27ClN4OS |
| Molecular Weight | 443.02 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 2-chloro-1-[4-[5,6-dimethyl-2-(2-phenylethyl)thieno[2,3-d]pyrimidin-4-yl]piperazin-1-yl]propan-1-one |
| SMILES | Cc1sc2nc(CCc3ccccc3)nc(N3CCN(C(=O)C(C)Cl)CC3)c2c1C |
| InChI | InChI=1S/C23H27ClN4OS/c1-15-17(3)30-22-20(15)21(27-11-13-28(14-12-27)23(29)16(2)24)25-19(26-22)10-9-18-7-5-4-6-8-18/h4-8,16H,9-14H2,1-3H3 |
| InChIKey | WVVADOJTVNURCH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.02 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|