C24H28N4OS — CID 42799736
(E)-1-[4-(5,6-dimethyl-2-propan-2-ylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 42799736) has the molecular formula C24H28N4OS and a molecular weight of 420.58 g/mol. Its IUPAC name is (E)-1-[4-(5,6-dimethyl-2-propan-2-ylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(5,6-dimethyl-2-propan-2-ylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 42799736 |
| Molecular Formula | C24H28N4OS |
| Molecular Weight | 420.58 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (E)-1-[4-(5,6-dimethyl-2-propan-2-ylthieno[2,3-d]pyrimidin-4-yl)piperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | Cc1sc2nc(C(C)C)nc(N3CCN(C(=O)/C=C/c4ccccc4)CC3)c2c1C |
| InChI | InChI=1S/C24H28N4OS/c1-16(2)22-25-23(21-17(3)18(4)30-24(21)26-22)28-14-12-27(13-15-28)20(29)11-10-19-8-6-5-7-9-19/h5-11,16H,12-15H2,1-4H3/b11-10+ |
| InChIKey | SLXYZYSJSFFVQY-ZHACJKMWSA-N |
| XLogP | 4.79 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.58 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|