C26H26ClN5S2 — CID 3212873
4-(2-benzyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N-(3-chlorophenyl)piperazine-1-carbothioamide (PubChem CID 3212873) has the molecular formula C26H26ClN5S2 and a molecular weight of 508.12 g/mol. Its IUPAC name is 4-(2-benzyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N-(3-chlorophenyl)piperazine-1-carbothioamide.
| Compound Name | 4-(2-benzyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N-(3-chlorophenyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3212873 |
| Molecular Formula | C26H26ClN5S2 |
| Molecular Weight | 508.12 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | 4-(2-benzyl-5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)-N-(3-chlorophenyl)piperazine-1-carbothioamide |
| SMILES | Cc1sc2nc(Cc3ccccc3)nc(N3CCN(C(=S)Nc4cccc(Cl)c4)CC3)c2c1C |
| InChI | InChI=1S/C26H26ClN5S2/c1-17-18(2)34-25-23(17)24(29-22(30-25)15-19-7-4-3-5-8-19)31-11-13-32(14-12-31)26(33)28-21-10-6-9-20(27)16-21/h3-10,16H,11-15H2,1-2H3,(H,28,33) |
| InChIKey | SHRRFCNYGUELLT-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.12 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|