C20H21N5S — CID 58727444
2-benzyl-6-isocyano-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine (PubChem CID 58727444) has the molecular formula C20H21N5S and a molecular weight of 363.49 g/mol. Its IUPAC name is 2-benzyl-6-isocyano-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine.
| Compound Name | 2-benzyl-6-isocyano-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 58727444 |
| Molecular Formula | C20H21N5S |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.15 |
| IUPAC Name | 2-benzyl-6-isocyano-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidine |
| SMILES | [C-]#[N+]c1sc2nc(Cc3ccccc3)nc(N3CCN(C)CC3)c2c1C |
| InChI | InChI=1S/C20H21N5S/c1-14-17-18(25-11-9-24(3)10-12-25)22-16(13-15-7-5-4-6-8-15)23-20(17)26-19(14)21-2/h4-8H,9-13H2,1,3H3 |
| InChIKey | UMIDDARDMMVEGQ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 36.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|