C21H21N5O2S — CID 58727438
methyl 4-[6-isocyano-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidin-2-yl]benzoate (PubChem CID 58727438) has the molecular formula C21H21N5O2S and a molecular weight of 407.50 g/mol. Its IUPAC name is methyl 4-[6-isocyano-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidin-2-yl]benzoate.
| Compound Name | methyl 4-[6-isocyano-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidin-2-yl]benzoate |
|---|---|
| PubChem CID | 58727438 |
| Molecular Formula | C21H21N5O2S |
| Molecular Weight | 407.50 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | methyl 4-[6-isocyano-5-methyl-4-(4-methylpiperazin-1-yl)thieno[2,3-d]pyrimidin-2-yl]benzoate |
| SMILES | [C-]#[N+]c1sc2nc(-c3ccc(C(=O)OC)cc3)nc(N3CCN(C)CC3)c2c1C |
| InChI | InChI=1S/C21H21N5O2S/c1-13-16-18(26-11-9-25(3)10-12-26)23-17(24-20(16)29-19(13)22-2)14-5-7-15(8-6-14)21(27)28-4/h5-8H,9-12H2,1,3-4H3 |
| InChIKey | YVTNNMCFCOUWSL-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 62.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|