C23H19ClN2O3 — CID 42801687
N-(4-benzyl-3-oxo-5H-1,4-benzoxazepin-7-yl)-4-chlorobenzamide (PubChem CID 42801687) has the molecular formula C23H19ClN2O3 and a molecular weight of 406.87 g/mol. Its IUPAC name is N-(4-benzyl-3-oxo-5H-1,4-benzoxazepin-7-yl)-4-chlorobenzamide.
| Compound Name | N-(4-benzyl-3-oxo-5H-1,4-benzoxazepin-7-yl)-4-chlorobenzamide |
|---|---|
| PubChem CID | 42801687 |
| Molecular Formula | C23H19ClN2O3 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-(4-benzyl-3-oxo-5H-1,4-benzoxazepin-7-yl)-4-chlorobenzamide |
| SMILES | O=C(Nc1ccc2c(c1)CN(Cc1ccccc1)C(=O)CO2)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H19ClN2O3/c24-19-8-6-17(7-9-19)23(28)25-20-10-11-21-18(12-20)14-26(22(27)15-29-21)13-16-4-2-1-3-5-16/h1-12H,13-15H2,(H,25,28) |
| InChIKey | CHJZKNLIIJCYBK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |