C26H26N2O5 — CID 42801703
3,5-dimethoxy-N-[3-oxo-4-(2-phenylethyl)-5H-1,4-benzoxazepin-7-yl]benzamide (PubChem CID 42801703) has the molecular formula C26H26N2O5 and a molecular weight of 446.50 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[3-oxo-4-(2-phenylethyl)-5H-1,4-benzoxazepin-7-yl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[3-oxo-4-(2-phenylethyl)-5H-1,4-benzoxazepin-7-yl]benzamide |
|---|---|
| PubChem CID | 42801703 |
| Molecular Formula | C26H26N2O5 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 3,5-dimethoxy-N-[3-oxo-4-(2-phenylethyl)-5H-1,4-benzoxazepin-7-yl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2ccc3c(c2)CN(CCc2ccccc2)C(=O)CO3)c1 |
| InChI | InChI=1S/C26H26N2O5/c1-31-22-13-19(14-23(15-22)32-2)26(30)27-21-8-9-24-20(12-21)16-28(25(29)17-33-24)11-10-18-6-4-3-5-7-18/h3-9,12-15H,10-11,16-17H2,1-2H3,(H,27,30) |
| InChIKey | ICUKGZWQQDWHMQ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |